C22H28N4O4 — CID 9390386
N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-1-(2-methylbenzoyl)piperidine-4-carboxamide (PubChem CID 9390386) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-1-(2-methylbenzoyl)piperidine-4-carboxamide.
| Compound Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-1-(2-methylbenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 9390386 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-1-(2-methylbenzoyl)piperidine-4-carboxamide |
| SMILES | Cc1ccccc1C(=O)N1CCC(C(=O)NN2C(=O)NC3(CCCCC3)C2=O)CC1 |
| InChI | InChI=1S/C22H28N4O4/c1-15-7-3-4-8-17(15)19(28)25-13-9-16(10-14-25)18(27)24-26-20(29)22(23-21(26)30)11-5-2-6-12-22/h3-4,7-8,16H,2,5-6,9-14H2,1H3,(H,23,30)(H,24,27) |
| InChIKey | BUQIREBELBVWIB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|