About [2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] acetate
[2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] acetate (PubChem CID 9390506) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is [2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] acetate.
Analyze [2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] acetate?
The IUPAC name of [2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] acetate (CID 9390506) is [2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] acetate.
What is the SMILES notation for [2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] acetate?
The canonical SMILES for [2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] acetate is CC(=O)OCC(=O)N1c2ccccc2C[C@@H]1C.
What is the InChIKey of [2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] acetate?
The InChIKey is FIDTYXMIZQIMMR-VIFPVBQESA-N. The full InChI is InChI=1S/C13H15NO3/c1-9-7-11-5-3-4-6-12(11)14(9)13(16)8-17-10(2)15/h3-6,9H,7-8H2,1-2H3/t9-/m0/s1.
What are the key properties of [2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] acetate?
[2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] acetate has a molecular weight of 233.27 g/mol, XLogP of 1.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] acetate is sourced from PubChem (CID 9390506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).