C22H26N4OS — CID 9392413
6-cyclopropyl-N-[2-(4-methylphenyl)sulfanylethyl]-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 9392413) has the molecular formula C22H26N4OS and a molecular weight of 394.54 g/mol. Its IUPAC name is 6-cyclopropyl-N-[2-(4-methylphenyl)sulfanylethyl]-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 6-cyclopropyl-N-[2-(4-methylphenyl)sulfanylethyl]-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 9392413 |
| Molecular Formula | C22H26N4OS |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 6-cyclopropyl-N-[2-(4-methylphenyl)sulfanylethyl]-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | Cc1ccc(SCCNC(=O)c2cc(C3CC3)nc3c2cnn3C(C)C)cc1 |
| InChI | InChI=1S/C22H26N4OS/c1-14(2)26-21-19(13-24-26)18(12-20(25-21)16-6-7-16)22(27)23-10-11-28-17-8-4-15(3)5-9-17/h4-5,8-9,12-14,16H,6-7,10-11H2,1-3H3,(H,23,27) |
| InChIKey | ZRNGYEKPZSZXGN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|