C21H15N3O5 — CID 9392750
2-[(Z)-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-6-nitrobenzo[de]isoquinoline-1,3-dione (PubChem CID 9392750) has the molecular formula C21H15N3O5 and a molecular weight of 389.37 g/mol. Its IUPAC name is 2-[(Z)-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-6-nitrobenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[(Z)-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-6-nitrobenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 9392750 |
| Molecular Formula | C21H15N3O5 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 2-[(Z)-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-6-nitrobenzo[de]isoquinoline-1,3-dione |
| SMILES | C[C@H]1C[C@@H]1c1ccc(/C=N\N2C(=O)c3cccc4c([N+](=O)[O-])ccc(c34)C2=O)o1 |
| InChI | InChI=1S/C21H15N3O5/c1-11-9-16(11)18-8-5-12(29-18)10-22-23-20(25)14-4-2-3-13-17(24(27)28)7-6-15(19(13)14)21(23)26/h2-8,10-11,16H,9H2,1H3/b22-10-/t11-,16-/m0/s1 |
| InChIKey | CSMNWRVRGGSYDR-DSRPCAHLSA-N |
| XLogP | 4.09 |
| TPSA | 106.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|