About 3-benzyl-6-ethoxy-2,4-dihydro-1,3-benzoxazine
3-benzyl-6-ethoxy-2,4-dihydro-1,3-benzoxazine (PubChem CID 939627) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is 3-benzyl-6-ethoxy-2,4-dihydro-1,3-benzoxazine.
Molecular Properties
| Compound Name | 3-benzyl-6-ethoxy-2,4-dihydro-1,3-benzoxazine |
| PubChem CID | 939627 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 3-benzyl-6-ethoxy-2,4-dihydro-1,3-benzoxazine |
| SMILES | CCOc1ccc2c(c1)CN(Cc1ccccc1)CO2 |
| InChI | InChI=1S/C17H19NO2/c1-2-19-16-8-9-17-15(10-16)12-18(13-20-17)11-14-6-4-3-5-7-14/h3-10H,2,11-13H2,1H3 |
| InChIKey | VXSWILXKJVNMHE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-benzyl-6-ethoxy-2,4-dihydro-1,3-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-6-ethoxy-2,4-dihydro-1,3-benzoxazine?
The IUPAC name of 3-benzyl-6-ethoxy-2,4-dihydro-1,3-benzoxazine (CID 939627) is 3-benzyl-6-ethoxy-2,4-dihydro-1,3-benzoxazine.
What is the SMILES notation for 3-benzyl-6-ethoxy-2,4-dihydro-1,3-benzoxazine?
The canonical SMILES for 3-benzyl-6-ethoxy-2,4-dihydro-1,3-benzoxazine is CCOc1ccc2c(c1)CN(Cc1ccccc1)CO2.
What is the InChIKey of 3-benzyl-6-ethoxy-2,4-dihydro-1,3-benzoxazine?
The InChIKey is VXSWILXKJVNMHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c1-2-19-16-8-9-17-15(10-16)12-18(13-20-17)11-14-6-4-3-5-7-14/h3-10H,2,11-13H2,1H3.
What are the key properties of 3-benzyl-6-ethoxy-2,4-dihydro-1,3-benzoxazine?
3-benzyl-6-ethoxy-2,4-dihydro-1,3-benzoxazine has a molecular weight of 269.34 g/mol, XLogP of 3.44, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-6-ethoxy-2,4-dihydro-1,3-benzoxazine is sourced from PubChem (CID 939627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).