About (2-acetamido-1,3-thiazol-4-yl)methyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate
(2-acetamido-1,3-thiazol-4-yl)methyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate (PubChem CID 9396693) has the molecular formula C16H15N3O5S
and a molecular weight of 361.38 g/mol. Its IUPAC name is (2-acetamido-1,3-thiazol-4-yl)methyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate.
Molecular Properties
| Compound Name | (2-acetamido-1,3-thiazol-4-yl)methyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate |
| PubChem CID | 9396693 |
| Molecular Formula | C16H15N3O5S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | (2-acetamido-1,3-thiazol-4-yl)methyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate |
| SMILES | CC(=O)Nc1nc(COC(=O)CCn2c(=O)oc3ccccc32)cs1 |
| InChI | InChI=1S/C16H15N3O5S/c1-10(20)17-15-18-11(9-25-15)8-23-14(21)6-7-19-12-4-2-3-5-13(12)24-16(19)22/h2-5,9H,6-8H2,1H3,(H,17,18,20) |
| InChIKey | SDTQTSJTZYRJSM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (2-acetamido-1,3-thiazol-4-yl)methyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetamido-1,3-thiazol-4-yl)methyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate?
The IUPAC name of (2-acetamido-1,3-thiazol-4-yl)methyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate (CID 9396693) is (2-acetamido-1,3-thiazol-4-yl)methyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate.
What is the SMILES notation for (2-acetamido-1,3-thiazol-4-yl)methyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate?
The canonical SMILES for (2-acetamido-1,3-thiazol-4-yl)methyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate is CC(=O)Nc1nc(COC(=O)CCn2c(=O)oc3ccccc32)cs1.
What is the InChIKey of (2-acetamido-1,3-thiazol-4-yl)methyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate?
The InChIKey is SDTQTSJTZYRJSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O5S/c1-10(20)17-15-18-11(9-25-15)8-23-14(21)6-7-19-12-4-2-3-5-13(12)24-16(19)22/h2-5,9H,6-8H2,1H3,(H,17,18,20).
What are the key properties of (2-acetamido-1,3-thiazol-4-yl)methyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate?
(2-acetamido-1,3-thiazol-4-yl)methyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate has a molecular weight of 361.38 g/mol, XLogP of 2.14, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetamido-1,3-thiazol-4-yl)methyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate is sourced from PubChem (CID 9396693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).