About N-methyl-7-methyliminocyclohepta-1,3,5-trien-1-amine
N-methyl-7-methyliminocyclohepta-1,3,5-trien-1-amine (PubChem CID 939724) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is N-methyl-7-methyliminocyclohepta-1,3,5-trien-1-amine.
Molecular Properties
| Compound Name | N-methyl-7-methyliminocyclohepta-1,3,5-trien-1-amine |
| PubChem CID | 939724 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | N-methyl-7-methyliminocyclohepta-1,3,5-trien-1-amine |
| SMILES | C/N=c1\cccccc1NC |
| InChI | InChI=1S/C9H12N2/c1-10-8-6-4-3-5-7-9(8)11-2/h3-7H,1-2H3,(H,10,11) |
| InChIKey | PVUJEIMMYXGDRV-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-7-methyliminocyclohepta-1,3,5-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-7-methyliminocyclohepta-1,3,5-trien-1-amine?
The IUPAC name of N-methyl-7-methyliminocyclohepta-1,3,5-trien-1-amine (CID 939724) is N-methyl-7-methyliminocyclohepta-1,3,5-trien-1-amine.
What is the SMILES notation for N-methyl-7-methyliminocyclohepta-1,3,5-trien-1-amine?
The canonical SMILES for N-methyl-7-methyliminocyclohepta-1,3,5-trien-1-amine is C/N=c1\cccccc1NC.
What is the InChIKey of N-methyl-7-methyliminocyclohepta-1,3,5-trien-1-amine?
The InChIKey is PVUJEIMMYXGDRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-10-8-6-4-3-5-7-9(8)11-2/h3-7H,1-2H3,(H,10,11).
What are the key properties of N-methyl-7-methyliminocyclohepta-1,3,5-trien-1-amine?
N-methyl-7-methyliminocyclohepta-1,3,5-trien-1-amine has a molecular weight of 148.21 g/mol, XLogP of 1.26, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-7-methyliminocyclohepta-1,3,5-trien-1-amine is sourced from PubChem (CID 939724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).