C24H27N2O3+ — CID 9397408
2-(2-methoxyphenoxy)-1-[4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-yl]ethanone (PubChem CID 9397408) has the molecular formula C24H27N2O3+ and a molecular weight of 391.49 g/mol. Its IUPAC name is 2-(2-methoxyphenoxy)-1-[4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-yl]ethanone.
| Compound Name | 2-(2-methoxyphenoxy)-1-[4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 9397408 |
| Molecular Formula | C24H27N2O3+ |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 2-(2-methoxyphenoxy)-1-[4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-yl]ethanone |
| SMILES | COc1ccccc1OCC(=O)N1CC[NH+](Cc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C24H26N2O3/c1-28-22-11-4-5-12-23(22)29-18-24(27)26-15-13-25(14-16-26)17-20-9-6-8-19-7-2-3-10-21(19)20/h2-12H,13-18H2,1H3/p+1 |
| InChIKey | LRUBVNRCOIWVMY-UHFFFAOYSA-O |
| XLogP | 2.15 |
| TPSA | 43.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |