About 5-[(2,5-dimethylpyrrol-3-ylidene)methyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione
5-[(2,5-dimethylpyrrol-3-ylidene)methyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione (PubChem CID 939765) has the molecular formula C17H15N3O3
and a molecular weight of 309.33 g/mol. Its IUPAC name is 5-[(2,5-dimethylpyrrol-3-ylidene)methyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-[(2,5-dimethylpyrrol-3-ylidene)methyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione |
| PubChem CID | 939765 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 5-[(2,5-dimethylpyrrol-3-ylidene)methyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione |
| SMILES | CC1=CC(=Cc2c(O)n(-c3ccccc3)c(=O)[nH]c2=O)C(C)=N1 |
| InChI | InChI=1S/C17H15N3O3/c1-10-8-12(11(2)18-10)9-14-15(21)19-17(23)20(16(14)22)13-6-4-3-5-7-13/h3-9,22H,1-2H3,(H,19,21,23) |
| InChIKey | PMMSNBABRPYEAL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(2,5-dimethylpyrrol-3-ylidene)methyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,5-dimethylpyrrol-3-ylidene)methyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione?
The IUPAC name of 5-[(2,5-dimethylpyrrol-3-ylidene)methyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione (CID 939765) is 5-[(2,5-dimethylpyrrol-3-ylidene)methyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione.
What is the SMILES notation for 5-[(2,5-dimethylpyrrol-3-ylidene)methyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione?
The canonical SMILES for 5-[(2,5-dimethylpyrrol-3-ylidene)methyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione is CC1=CC(=Cc2c(O)n(-c3ccccc3)c(=O)[nH]c2=O)C(C)=N1.
What is the InChIKey of 5-[(2,5-dimethylpyrrol-3-ylidene)methyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione?
The InChIKey is PMMSNBABRPYEAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O3/c1-10-8-12(11(2)18-10)9-14-15(21)19-17(23)20(16(14)22)13-6-4-3-5-7-13/h3-9,22H,1-2H3,(H,19,21,23).
What are the key properties of 5-[(2,5-dimethylpyrrol-3-ylidene)methyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione?
5-[(2,5-dimethylpyrrol-3-ylidene)methyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione has a molecular weight of 309.33 g/mol, XLogP of 1.99, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,5-dimethylpyrrol-3-ylidene)methyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione is sourced from PubChem (CID 939765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).