C20H21N3O2S — CID 9400100
2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]acetamide (PubChem CID 9400100) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 9400100 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]acetamide |
| SMILES | Cc1noc(C)c1CC(=O)Nc1nc(-c2ccc3c(c2)CCCC3)cs1 |
| InChI | InChI=1S/C20H21N3O2S/c1-12-17(13(2)25-23-12)10-19(24)22-20-21-18(11-26-20)16-8-7-14-5-3-4-6-15(14)9-16/h7-9,11H,3-6,10H2,1-2H3,(H,21,22,24) |
| InChIKey | JZBGJRDKBOSWSC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |