About 2-[2-(1,3-thiazol-4-yl)benzimidazol-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide
2-[2-(1,3-thiazol-4-yl)benzimidazol-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 9400179) has the molecular formula C19H13F3N4OS
and a molecular weight of 402.40 g/mol. Its IUPAC name is 2-[2-(1,3-thiazol-4-yl)benzimidazol-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide.
Molecular Properties
| Compound Name | 2-[2-(1,3-thiazol-4-yl)benzimidazol-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide |
| PubChem CID | 9400179 |
| Molecular Formula | C19H13F3N4OS |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 2-[2-(1,3-thiazol-4-yl)benzimidazol-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cn1c(-c2cscn2)nc2ccccc21)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H13F3N4OS/c20-19(21,22)12-5-7-13(8-6-12)24-17(27)9-26-16-4-2-1-3-14(16)25-18(26)15-10-28-11-23-15/h1-8,10-11H,9H2,(H,24,27) |
| InChIKey | JEKPMMKYMMSUBJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-(1,3-thiazol-4-yl)benzimidazol-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1,3-thiazol-4-yl)benzimidazol-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide?
The IUPAC name of 2-[2-(1,3-thiazol-4-yl)benzimidazol-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide (CID 9400179) is 2-[2-(1,3-thiazol-4-yl)benzimidazol-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide.
What is the SMILES notation for 2-[2-(1,3-thiazol-4-yl)benzimidazol-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide?
The canonical SMILES for 2-[2-(1,3-thiazol-4-yl)benzimidazol-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide is O=C(Cn1c(-c2cscn2)nc2ccccc21)Nc1ccc(C(F)(F)F)cc1.
What is the InChIKey of 2-[2-(1,3-thiazol-4-yl)benzimidazol-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide?
The InChIKey is JEKPMMKYMMSUBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13F3N4OS/c20-19(21,22)12-5-7-13(8-6-12)24-17(27)9-26-16-4-2-1-3-14(16)25-18(26)15-10-28-11-23-15/h1-8,10-11H,9H2,(H,24,27).
What are the key properties of 2-[2-(1,3-thiazol-4-yl)benzimidazol-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide?
2-[2-(1,3-thiazol-4-yl)benzimidazol-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide has a molecular weight of 402.40 g/mol, XLogP of 4.82, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,3-thiazol-4-yl)benzimidazol-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide is sourced from PubChem (CID 9400179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).