About 9H-fluoren-9-ylmethyl N-[5-[(E)-N'-hydroxycarbamimidoyl]-2-pyridinyl]carbamate
9H-fluoren-9-ylmethyl N-[5-[(E)-N'-hydroxycarbamimidoyl]-2-pyridinyl]carbamate (PubChem CID 94004156) has the molecular formula C21H18N4O3
and a molecular weight of 374.40 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[5-[(E)-N'-hydroxycarbamimidoyl]-2-pyridinyl]carbamate.
Molecular Properties
| Compound Name | 9H-fluoren-9-ylmethyl N-[5-[(E)-N'-hydroxycarbamimidoyl]-2-pyridinyl]carbamate |
| PubChem CID | 94004156 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[5-[(E)-N'-hydroxycarbamimidoyl]-2-pyridinyl]carbamate |
| SMILES | N/C(=N/O)c1ccc(NC(=O)OCC2c3ccccc3-c3ccccc32)nc1 |
| InChI | InChI=1S/C21H18N4O3/c22-20(25-27)13-9-10-19(23-11-13)24-21(26)28-12-18-16-7-3-1-5-14(16)15-6-2-4-8-17(15)18/h1-11,18,27H,12H2,(H2,22,25)(H,23,24,26) |
| InChIKey | WLUZWRQIWQNQRU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluoren-9-ylmethyl N-[5-[(E)-N'-hydroxycarbamimidoyl]-2-pyridinyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-9-ylmethyl N-[5-[(E)-N'-hydroxycarbamimidoyl]-2-pyridinyl]carbamate?
The IUPAC name of 9H-fluoren-9-ylmethyl N-[5-[(E)-N'-hydroxycarbamimidoyl]-2-pyridinyl]carbamate (CID 94004156) is 9H-fluoren-9-ylmethyl N-[5-[(E)-N'-hydroxycarbamimidoyl]-2-pyridinyl]carbamate.
What is the SMILES notation for 9H-fluoren-9-ylmethyl N-[5-[(E)-N'-hydroxycarbamimidoyl]-2-pyridinyl]carbamate?
The canonical SMILES for 9H-fluoren-9-ylmethyl N-[5-[(E)-N'-hydroxycarbamimidoyl]-2-pyridinyl]carbamate is N/C(=N/O)c1ccc(NC(=O)OCC2c3ccccc3-c3ccccc32)nc1.
What is the InChIKey of 9H-fluoren-9-ylmethyl N-[5-[(E)-N'-hydroxycarbamimidoyl]-2-pyridinyl]carbamate?
The InChIKey is WLUZWRQIWQNQRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N4O3/c22-20(25-27)13-9-10-19(23-11-13)24-21(26)28-12-18-16-7-3-1-5-14(16)15-6-2-4-8-17(15)18/h1-11,18,27H,12H2,(H2,22,25)(H,23,24,26).
What are the key properties of 9H-fluoren-9-ylmethyl N-[5-[(E)-N'-hydroxycarbamimidoyl]-2-pyridinyl]carbamate?
9H-fluoren-9-ylmethyl N-[5-[(E)-N'-hydroxycarbamimidoyl]-2-pyridinyl]carbamate has a molecular weight of 374.40 g/mol, XLogP of 3.54, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-9-ylmethyl N-[5-[(E)-N'-hydroxycarbamimidoyl]-2-pyridinyl]carbamate is sourced from PubChem (CID 94004156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).