C13H20O3 — CID 94006003
methyl 2-[(1S,2Z)-3-oxo-2-pentylidenecyclopentyl]acetate (PubChem CID 94006003) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is methyl 2-[(1S,2Z)-3-oxo-2-pentylidenecyclopentyl]acetate.
| Compound Name | methyl 2-[(1S,2Z)-3-oxo-2-pentylidenecyclopentyl]acetate |
|---|---|
| PubChem CID | 94006003 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | methyl 2-[(1S,2Z)-3-oxo-2-pentylidenecyclopentyl]acetate |
| SMILES | CCCC/C=C1\C(=O)CC[C@H]1CC(=O)OC |
| InChI | InChI=1S/C13H20O3/c1-3-4-5-6-11-10(7-8-12(11)14)9-13(15)16-2/h6,10H,3-5,7-9H2,1-2H3/b11-6-/t10-/m0/s1 |
| InChIKey | BJWUCYNWZYDBHN-OYUORYAFSA-N |
| XLogP | 2.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|