C22H25N5O — CID 94006204
(2R)-2-tert-butyl-N'-pyrimidin-2-yl-1,2,3,4-tetrahydroacridine-9-carbohydrazide (PubChem CID 94006204) has the molecular formula C22H25N5O and a molecular weight of 375.48 g/mol. Its IUPAC name is (2R)-2-tert-butyl-N'-pyrimidin-2-yl-1,2,3,4-tetrahydroacridine-9-carbohydrazide.
| Compound Name | (2R)-2-tert-butyl-N'-pyrimidin-2-yl-1,2,3,4-tetrahydroacridine-9-carbohydrazide |
|---|---|
| PubChem CID | 94006204 |
| Molecular Formula | C22H25N5O |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | (2R)-2-tert-butyl-N'-pyrimidin-2-yl-1,2,3,4-tetrahydroacridine-9-carbohydrazide |
| SMILES | CC(C)(C)[C@@H]1CCc2nc3ccccc3c(C(=O)NNc3ncccn3)c2C1 |
| InChI | InChI=1S/C22H25N5O/c1-22(2,3)14-9-10-18-16(13-14)19(15-7-4-5-8-17(15)25-18)20(28)26-27-21-23-11-6-12-24-21/h4-8,11-12,14H,9-10,13H2,1-3H3,(H,26,28)(H,23,24,27)/t14-/m1/s1 |
| InChIKey | DQNCUXSMTGCOAD-CQSZACIVSA-N |
| XLogP | 3.93 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|