C24H26BrNO3 — CID 94011986
2-(1-bromonaphthalen-2-yl)oxy-N-[(1S)-1-(4-methoxyphenyl)-3-methylbutyl]acetamide (PubChem CID 94011986) has the molecular formula C24H26BrNO3 and a molecular weight of 456.38 g/mol. Its IUPAC name is 2-(1-bromonaphthalen-2-yl)oxy-N-[(1S)-1-(4-methoxyphenyl)-3-methylbutyl]acetamide.
| Compound Name | 2-(1-bromonaphthalen-2-yl)oxy-N-[(1S)-1-(4-methoxyphenyl)-3-methylbutyl]acetamide |
|---|---|
| PubChem CID | 94011986 |
| Molecular Formula | C24H26BrNO3 |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 2-(1-bromonaphthalen-2-yl)oxy-N-[(1S)-1-(4-methoxyphenyl)-3-methylbutyl]acetamide |
| SMILES | COc1ccc([C@H](CC(C)C)NC(=O)COc2ccc3ccccc3c2Br)cc1 |
| InChI | InChI=1S/C24H26BrNO3/c1-16(2)14-21(18-8-11-19(28-3)12-9-18)26-23(27)15-29-22-13-10-17-6-4-5-7-20(17)24(22)25/h4-13,16,21H,14-15H2,1-3H3,(H,26,27)/t21-/m0/s1 |
| InChIKey | XUTNPXBXSDIVFX-NRFANRHFSA-N |
| XLogP | 5.89 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |