C27H37N3O — CID 94013631
1-benzyl-N-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]piperidine-4-carboxamide (PubChem CID 94013631) has the molecular formula C27H37N3O and a molecular weight of 419.61 g/mol. Its IUPAC name is 1-benzyl-N-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-benzyl-N-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 94013631 |
| Molecular Formula | C27H37N3O |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | 1-benzyl-N-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]piperidine-4-carboxamide |
| SMILES | CC1CCN(c2ccc([C@@H](C)NC(=O)C3CCN(Cc4ccccc4)CC3)cc2)CC1 |
| InChI | InChI=1S/C27H37N3O/c1-21-12-18-30(19-13-21)26-10-8-24(9-11-26)22(2)28-27(31)25-14-16-29(17-15-25)20-23-6-4-3-5-7-23/h3-11,21-22,25H,12-20H2,1-2H3,(H,28,31)/t22-/m1/s1 |
| InChIKey | YMXCQIXSBZJUDF-JOCHJYFZSA-N |
| XLogP | 5.01 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|