C16H19N3OS — CID 94014669
(2R)-1-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperidine-2-carboxamide (PubChem CID 94014669) has the molecular formula C16H19N3OS and a molecular weight of 301.41 g/mol. Its IUPAC name is (2R)-1-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperidine-2-carboxamide.
| Compound Name | (2R)-1-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 94014669 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | (2R)-1-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperidine-2-carboxamide |
| SMILES | NC(=O)[C@H]1CCCCN1Cc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H19N3OS/c17-15(20)14-8-4-5-9-19(14)10-13-11-21-16(18-13)12-6-2-1-3-7-12/h1-3,6-7,11,14H,4-5,8-10H2,(H2,17,20)/t14-/m1/s1 |
| InChIKey | YZILFNXZYAZQRX-CQSZACIVSA-N |
| XLogP | 2.65 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |