About N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-6-oxo-1-propylpyridazine-3-carboxamide
N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-6-oxo-1-propylpyridazine-3-carboxamide (PubChem CID 94014684) has the molecular formula C13H19N3O4S
and a molecular weight of 313.38 g/mol. Its IUPAC name is N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-6-oxo-1-propylpyridazine-3-carboxamide.
Molecular Properties
| Compound Name | N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-6-oxo-1-propylpyridazine-3-carboxamide |
| PubChem CID | 94014684 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-6-oxo-1-propylpyridazine-3-carboxamide |
| SMILES | CCCn1nc(C(=O)N[C@@]2(C)CCS(=O)(=O)C2)ccc1=O |
| InChI | InChI=1S/C13H19N3O4S/c1-3-7-16-11(17)5-4-10(15-16)12(18)14-13(2)6-8-21(19,20)9-13/h4-5H,3,6-9H2,1-2H3,(H,14,18)/t13-/m0/s1 |
| InChIKey | MQZWPZBQACEGIY-ZDUSSCGKSA-N |
| XLogP | -0.04 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-6-oxo-1-propylpyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-6-oxo-1-propylpyridazine-3-carboxamide?
The IUPAC name of N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-6-oxo-1-propylpyridazine-3-carboxamide (CID 94014684) is N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-6-oxo-1-propylpyridazine-3-carboxamide.
What is the SMILES notation for N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-6-oxo-1-propylpyridazine-3-carboxamide?
The canonical SMILES for N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-6-oxo-1-propylpyridazine-3-carboxamide is CCCn1nc(C(=O)N[C@@]2(C)CCS(=O)(=O)C2)ccc1=O.
What is the InChIKey of N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-6-oxo-1-propylpyridazine-3-carboxamide?
The InChIKey is MQZWPZBQACEGIY-ZDUSSCGKSA-N. The full InChI is InChI=1S/C13H19N3O4S/c1-3-7-16-11(17)5-4-10(15-16)12(18)14-13(2)6-8-21(19,20)9-13/h4-5H,3,6-9H2,1-2H3,(H,14,18)/t13-/m0/s1.
What are the key properties of N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-6-oxo-1-propylpyridazine-3-carboxamide?
N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-6-oxo-1-propylpyridazine-3-carboxamide has a molecular weight of 313.38 g/mol, XLogP of -0.04, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-6-oxo-1-propylpyridazine-3-carboxamide is sourced from PubChem (CID 94014684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).