About (2R,6S)-4-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylmorpholine
(2R,6S)-4-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylmorpholine (PubChem CID 94015004) has the molecular formula C12H23N5O
and a molecular weight of 253.35 g/mol. Its IUPAC name is (2R,6S)-4-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | (2R,6S)-4-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylmorpholine |
| PubChem CID | 94015004 |
| Molecular Formula | C12H23N5O |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | (2R,6S)-4-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylmorpholine |
| SMILES | CCCCn1nnnc1CN1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C12H23N5O/c1-4-5-6-17-12(13-14-15-17)9-16-7-10(2)18-11(3)8-16/h10-11H,4-9H2,1-3H3/t10-,11+ |
| InChIKey | VLPYGVMKVCCVRI-PHIMTYICSA-N |
| XLogP | 1.08 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2R,6S)-4-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6S)-4-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylmorpholine?
The IUPAC name of (2R,6S)-4-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylmorpholine (CID 94015004) is (2R,6S)-4-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylmorpholine.
What is the SMILES notation for (2R,6S)-4-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylmorpholine?
The canonical SMILES for (2R,6S)-4-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylmorpholine is CCCCn1nnnc1CN1C[C@@H](C)O[C@@H](C)C1.
What is the InChIKey of (2R,6S)-4-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylmorpholine?
The InChIKey is VLPYGVMKVCCVRI-PHIMTYICSA-N. The full InChI is InChI=1S/C12H23N5O/c1-4-5-6-17-12(13-14-15-17)9-16-7-10(2)18-11(3)8-16/h10-11H,4-9H2,1-3H3/t10-,11+.
What are the key properties of (2R,6S)-4-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylmorpholine?
(2R,6S)-4-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylmorpholine has a molecular weight of 253.35 g/mol, XLogP of 1.08, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6S)-4-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylmorpholine is sourced from PubChem (CID 94015004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).