C26H26ClNO3 — CID 94016671
(2R)-N-[3-(4-tert-butylbenzoyl)phenyl]-2-(4-chlorophenoxy)propanamide (PubChem CID 94016671) has the molecular formula C26H26ClNO3 and a molecular weight of 435.95 g/mol. Its IUPAC name is (2R)-N-[3-(4-tert-butylbenzoyl)phenyl]-2-(4-chlorophenoxy)propanamide.
| Compound Name | (2R)-N-[3-(4-tert-butylbenzoyl)phenyl]-2-(4-chlorophenoxy)propanamide |
|---|---|
| PubChem CID | 94016671 |
| Molecular Formula | C26H26ClNO3 |
| Molecular Weight | 435.95 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | (2R)-N-[3-(4-tert-butylbenzoyl)phenyl]-2-(4-chlorophenoxy)propanamide |
| SMILES | C[C@@H](Oc1ccc(Cl)cc1)C(=O)Nc1cccc(C(=O)c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C26H26ClNO3/c1-17(31-23-14-12-21(27)13-15-23)25(30)28-22-7-5-6-19(16-22)24(29)18-8-10-20(11-9-18)26(2,3)4/h5-17H,1-4H3,(H,28,30)/t17-/m1/s1 |
| InChIKey | OORBTSVQPTVZAK-QGZVFWFLSA-N |
| XLogP | 6.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.95 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |