C17H20N2O5 — CID 94017448
(7aR)-2-[(2S)-3-(3-acetylphenoxy)-2-hydroxypropyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 94017448) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is (7aR)-2-[(2S)-3-(3-acetylphenoxy)-2-hydroxypropyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | (7aR)-2-[(2S)-3-(3-acetylphenoxy)-2-hydroxypropyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 94017448 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (7aR)-2-[(2S)-3-(3-acetylphenoxy)-2-hydroxypropyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | CC(=O)c1cccc(OC[C@@H](O)CN2C(=O)[C@H]3CCCN3C2=O)c1 |
| InChI | InChI=1S/C17H20N2O5/c1-11(20)12-4-2-5-14(8-12)24-10-13(21)9-19-16(22)15-6-3-7-18(15)17(19)23/h2,4-5,8,13,15,21H,3,6-7,9-10H2,1H3/t13-,15+/m0/s1 |
| InChIKey | CHDHQBHHYGBQGP-DZGCQCFKSA-N |
| XLogP | 1.06 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|