C13H15F3N2O3 — CID 94017593
1-[2-[(2S)-2-methylmorpholin-4-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 94017593) has the molecular formula C13H15F3N2O3 and a molecular weight of 304.27 g/mol. Its IUPAC name is 1-[2-[(2S)-2-methylmorpholin-4-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[2-[(2S)-2-methylmorpholin-4-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 94017593 |
| Molecular Formula | C13H15F3N2O3 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1-[2-[(2S)-2-methylmorpholin-4-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | C[C@H]1CN(C(=O)Cn2cc(C(F)(F)F)ccc2=O)CCO1 |
| InChI | InChI=1S/C13H15F3N2O3/c1-9-6-17(4-5-21-9)12(20)8-18-7-10(13(14,15)16)2-3-11(18)19/h2-3,7,9H,4-6,8H2,1H3/t9-/m0/s1 |
| InChIKey | HIDOIONWXDWOLH-VIFPVBQESA-N |
| XLogP | 1.11 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |