C12H13N3OS — CID 94017809
(2R)-2-(1-methylimidazol-2-yl)sulfanyl-2-phenylacetamide (PubChem CID 94017809) has the molecular formula C12H13N3OS and a molecular weight of 247.32 g/mol. Its IUPAC name is (2R)-2-(1-methylimidazol-2-yl)sulfanyl-2-phenylacetamide.
| Compound Name | (2R)-2-(1-methylimidazol-2-yl)sulfanyl-2-phenylacetamide |
|---|---|
| PubChem CID | 94017809 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | (2R)-2-(1-methylimidazol-2-yl)sulfanyl-2-phenylacetamide |
| SMILES | Cn1ccnc1S[C@@H](C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C12H13N3OS/c1-15-8-7-14-12(15)17-10(11(13)16)9-5-3-2-4-6-9/h2-8,10H,1H3,(H2,13,16)/t10-/m1/s1 |
| InChIKey | XOABFASBUSENPT-SNVBAGLBSA-N |
| XLogP | 1.74 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |