C20H22N2O2 — CID 94019220
(2S)-N-[4-(cyanomethyl)phenyl]-2-(2,3,5-trimethylphenoxy)propanamide (PubChem CID 94019220) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is (2S)-N-[4-(cyanomethyl)phenyl]-2-(2,3,5-trimethylphenoxy)propanamide.
| Compound Name | (2S)-N-[4-(cyanomethyl)phenyl]-2-(2,3,5-trimethylphenoxy)propanamide |
|---|---|
| PubChem CID | 94019220 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (2S)-N-[4-(cyanomethyl)phenyl]-2-(2,3,5-trimethylphenoxy)propanamide |
| SMILES | Cc1cc(C)c(C)c(O[C@@H](C)C(=O)Nc2ccc(CC#N)cc2)c1 |
| InChI | InChI=1S/C20H22N2O2/c1-13-11-14(2)15(3)19(12-13)24-16(4)20(23)22-18-7-5-17(6-8-18)9-10-21/h5-8,11-12,16H,9H2,1-4H3,(H,22,23)/t16-/m0/s1 |
| InChIKey | WZQDRXXURQATBE-INIZCTEOSA-N |
| XLogP | 4.08 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |