C24H26N2O4 — CID 94019315
2-[[(2S)-2-(3,4-dimethylphenoxy)butanoyl]amino]-N-(furan-2-ylmethyl)benzamide (PubChem CID 94019315) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is 2-[[(2S)-2-(3,4-dimethylphenoxy)butanoyl]amino]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 2-[[(2S)-2-(3,4-dimethylphenoxy)butanoyl]amino]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 94019315 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 2-[[(2S)-2-(3,4-dimethylphenoxy)butanoyl]amino]-N-(furan-2-ylmethyl)benzamide |
| SMILES | CC[C@H](Oc1ccc(C)c(C)c1)C(=O)Nc1ccccc1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C24H26N2O4/c1-4-22(30-18-12-11-16(2)17(3)14-18)24(28)26-21-10-6-5-9-20(21)23(27)25-15-19-8-7-13-29-19/h5-14,22H,4,15H2,1-3H3,(H,25,27)(H,26,28)/t22-/m0/s1 |
| InChIKey | HBCDFSATXXNFGV-QFIPXVFZSA-N |
| XLogP | 4.62 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |