C26H30N2O5S — CID 94019420
N-[(1R)-1-(4-ethoxyphenyl)ethyl]-2-(N-(4-methoxyphenyl)sulfonyl-4-methylanilino)acetamide (PubChem CID 94019420) has the molecular formula C26H30N2O5S and a molecular weight of 482.60 g/mol. Its IUPAC name is N-[(1R)-1-(4-ethoxyphenyl)ethyl]-2-(N-(4-methoxyphenyl)sulfonyl-4-methylanilino)acetamide.
| Compound Name | N-[(1R)-1-(4-ethoxyphenyl)ethyl]-2-(N-(4-methoxyphenyl)sulfonyl-4-methylanilino)acetamide |
|---|---|
| PubChem CID | 94019420 |
| Molecular Formula | C26H30N2O5S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | N-[(1R)-1-(4-ethoxyphenyl)ethyl]-2-(N-(4-methoxyphenyl)sulfonyl-4-methylanilino)acetamide |
| SMILES | CCOc1ccc([C@@H](C)NC(=O)CN(c2ccc(C)cc2)S(=O)(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H30N2O5S/c1-5-33-24-12-8-21(9-13-24)20(3)27-26(29)18-28(22-10-6-19(2)7-11-22)34(30,31)25-16-14-23(32-4)15-17-25/h6-17,20H,5,18H2,1-4H3,(H,27,29)/t20-/m1/s1 |
| InChIKey | IAOHHFGCUJJJQJ-HXUWFJFHSA-N |
| XLogP | 4.48 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |