C18H22N2O2 — CID 94019548
(2S)-2-(3,4-dimethylphenoxy)-N-(pyridin-4-ylmethyl)butanamide (PubChem CID 94019548) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is (2S)-2-(3,4-dimethylphenoxy)-N-(pyridin-4-ylmethyl)butanamide.
| Compound Name | (2S)-2-(3,4-dimethylphenoxy)-N-(pyridin-4-ylmethyl)butanamide |
|---|---|
| PubChem CID | 94019548 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (2S)-2-(3,4-dimethylphenoxy)-N-(pyridin-4-ylmethyl)butanamide |
| SMILES | CC[C@H](Oc1ccc(C)c(C)c1)C(=O)NCc1ccncc1 |
| InChI | InChI=1S/C18H22N2O2/c1-4-17(22-16-6-5-13(2)14(3)11-16)18(21)20-12-15-7-9-19-10-8-15/h5-11,17H,4,12H2,1-3H3,(H,20,21)/t17-/m0/s1 |
| InChIKey | KYAAOSWIGJQEEL-KRWDZBQOSA-N |
| XLogP | 3.17 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |