C20H23FN2O4S — CID 94020485
(2S)-N-[3-(4-fluorophenyl)propyl]-5-methylsulfonyl-3,4-dihydro-2H-1,5-benzoxazepine-2-carboxamide (PubChem CID 94020485) has the molecular formula C20H23FN2O4S and a molecular weight of 406.48 g/mol. Its IUPAC name is (2S)-N-[3-(4-fluorophenyl)propyl]-5-methylsulfonyl-3,4-dihydro-2H-1,5-benzoxazepine-2-carboxamide.
| Compound Name | (2S)-N-[3-(4-fluorophenyl)propyl]-5-methylsulfonyl-3,4-dihydro-2H-1,5-benzoxazepine-2-carboxamide |
|---|---|
| PubChem CID | 94020485 |
| Molecular Formula | C20H23FN2O4S |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | (2S)-N-[3-(4-fluorophenyl)propyl]-5-methylsulfonyl-3,4-dihydro-2H-1,5-benzoxazepine-2-carboxamide |
| SMILES | CS(=O)(=O)N1CC[C@@H](C(=O)NCCCc2ccc(F)cc2)Oc2ccccc21 |
| InChI | InChI=1S/C20H23FN2O4S/c1-28(25,26)23-14-12-19(27-18-7-3-2-6-17(18)23)20(24)22-13-4-5-15-8-10-16(21)11-9-15/h2-3,6-11,19H,4-5,12-14H2,1H3,(H,22,24)/t19-/m0/s1 |
| InChIKey | YCJMSNBUKFOLIV-IBGZPJMESA-N |
| XLogP | 2.49 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|