About (2S)-2-(1,2,4-triazol-1-yl)-1-[(3S)-3-(trifluoromethyl)piperidin-1-yl]propan-1-one
(2S)-2-(1,2,4-triazol-1-yl)-1-[(3S)-3-(trifluoromethyl)piperidin-1-yl]propan-1-one (PubChem CID 94020952) has the molecular formula C11H15F3N4O
and a molecular weight of 276.26 g/mol. Its IUPAC name is (2S)-2-(1,2,4-triazol-1-yl)-1-[(3S)-3-(trifluoromethyl)piperidin-1-yl]propan-1-one.
Molecular Properties
| Compound Name | (2S)-2-(1,2,4-triazol-1-yl)-1-[(3S)-3-(trifluoromethyl)piperidin-1-yl]propan-1-one |
| PubChem CID | 94020952 |
| Molecular Formula | C11H15F3N4O |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (2S)-2-(1,2,4-triazol-1-yl)-1-[(3S)-3-(trifluoromethyl)piperidin-1-yl]propan-1-one |
| SMILES | C[C@@H](C(=O)N1CCC[C@H](C(F)(F)F)C1)n1cncn1 |
| InChI | InChI=1S/C11H15F3N4O/c1-8(18-7-15-6-16-18)10(19)17-4-2-3-9(5-17)11(12,13)14/h6-9H,2-5H2,1H3/t8-,9-/m0/s1 |
| InChIKey | MUXTXCHRVUHKKO-IUCAKERBSA-N |
| XLogP | 1.64 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-(1,2,4-triazol-1-yl)-1-[(3S)-3-(trifluoromethyl)piperidin-1-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(1,2,4-triazol-1-yl)-1-[(3S)-3-(trifluoromethyl)piperidin-1-yl]propan-1-one?
The IUPAC name of (2S)-2-(1,2,4-triazol-1-yl)-1-[(3S)-3-(trifluoromethyl)piperidin-1-yl]propan-1-one (CID 94020952) is (2S)-2-(1,2,4-triazol-1-yl)-1-[(3S)-3-(trifluoromethyl)piperidin-1-yl]propan-1-one.
What is the SMILES notation for (2S)-2-(1,2,4-triazol-1-yl)-1-[(3S)-3-(trifluoromethyl)piperidin-1-yl]propan-1-one?
The canonical SMILES for (2S)-2-(1,2,4-triazol-1-yl)-1-[(3S)-3-(trifluoromethyl)piperidin-1-yl]propan-1-one is C[C@@H](C(=O)N1CCC[C@H](C(F)(F)F)C1)n1cncn1.
What is the InChIKey of (2S)-2-(1,2,4-triazol-1-yl)-1-[(3S)-3-(trifluoromethyl)piperidin-1-yl]propan-1-one?
The InChIKey is MUXTXCHRVUHKKO-IUCAKERBSA-N. The full InChI is InChI=1S/C11H15F3N4O/c1-8(18-7-15-6-16-18)10(19)17-4-2-3-9(5-17)11(12,13)14/h6-9H,2-5H2,1H3/t8-,9-/m0/s1.
What are the key properties of (2S)-2-(1,2,4-triazol-1-yl)-1-[(3S)-3-(trifluoromethyl)piperidin-1-yl]propan-1-one?
(2S)-2-(1,2,4-triazol-1-yl)-1-[(3S)-3-(trifluoromethyl)piperidin-1-yl]propan-1-one has a molecular weight of 276.26 g/mol, XLogP of 1.64, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(1,2,4-triazol-1-yl)-1-[(3S)-3-(trifluoromethyl)piperidin-1-yl]propan-1-one is sourced from PubChem (CID 94020952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).