C18H26N4O — CID 94022364
[(1S)-cyclohex-3-en-1-yl]-[(2S)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)pyrrolidin-1-yl]methanone (PubChem CID 94022364) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is [(1S)-cyclohex-3-en-1-yl]-[(2S)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)pyrrolidin-1-yl]methanone.
| Compound Name | [(1S)-cyclohex-3-en-1-yl]-[(2S)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 94022364 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | [(1S)-cyclohex-3-en-1-yl]-[(2S)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)pyrrolidin-1-yl]methanone |
| SMILES | O=C([C@@H]1CC=CCC1)N1CCC[C@H]1c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C18H26N4O/c23-18(14-8-3-1-4-9-14)21-13-7-10-15(21)17-20-19-16-11-5-2-6-12-22(16)17/h1,3,14-15H,2,4-13H2/t14-,15+/m1/s1 |
| InChIKey | XBQVCAXJRHPSEG-CABCVRRESA-N |
| XLogP | 3.02 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|