C21H33N3O — CID 94022373
4-[[(3R)-3-methylpiperidin-1-yl]methyl]-N-(3-pyrrolidin-1-ylpropyl)benzamide (PubChem CID 94022373) has the molecular formula C21H33N3O and a molecular weight of 343.51 g/mol. Its IUPAC name is 4-[[(3R)-3-methylpiperidin-1-yl]methyl]-N-(3-pyrrolidin-1-ylpropyl)benzamide.
| Compound Name | 4-[[(3R)-3-methylpiperidin-1-yl]methyl]-N-(3-pyrrolidin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 94022373 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | 4-[[(3R)-3-methylpiperidin-1-yl]methyl]-N-(3-pyrrolidin-1-ylpropyl)benzamide |
| SMILES | C[C@@H]1CCCN(Cc2ccc(C(=O)NCCCN3CCCC3)cc2)C1 |
| InChI | InChI=1S/C21H33N3O/c1-18-6-4-14-24(16-18)17-19-7-9-20(10-8-19)21(25)22-11-5-15-23-12-2-3-13-23/h7-10,18H,2-6,11-17H2,1H3,(H,22,25)/t18-/m1/s1 |
| InChIKey | UGNFZCIVUXREEA-GOSISDBHSA-N |
| XLogP | 3.13 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|