C14H24N4O4S — CID 94025288
1-methyl-N-[(2S)-2-morpholin-4-yl-2-[(3S)-oxolan-3-yl]ethyl]pyrazole-4-sulfonamide (PubChem CID 94025288) has the molecular formula C14H24N4O4S and a molecular weight of 344.44 g/mol. Its IUPAC name is 1-methyl-N-[(2S)-2-morpholin-4-yl-2-[(3S)-oxolan-3-yl]ethyl]pyrazole-4-sulfonamide.
| Compound Name | 1-methyl-N-[(2S)-2-morpholin-4-yl-2-[(3S)-oxolan-3-yl]ethyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 94025288 |
| Molecular Formula | C14H24N4O4S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 1-methyl-N-[(2S)-2-morpholin-4-yl-2-[(3S)-oxolan-3-yl]ethyl]pyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)NC[C@H]([C@@H]2CCOC2)N2CCOCC2)cn1 |
| InChI | InChI=1S/C14H24N4O4S/c1-17-10-13(8-15-17)23(19,20)16-9-14(12-2-5-22-11-12)18-3-6-21-7-4-18/h8,10,12,14,16H,2-7,9,11H2,1H3/t12-,14-/m1/s1 |
| InChIKey | NWFWUVUDSREEBV-TZMCWYRMSA-N |
| XLogP | -0.56 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |