C24H29ClN2O5S — CID 94027087
ethyl 3-chloro-4-[[(3R)-1-(3-phenylpropylsulfonyl)piperidine-3-carbonyl]amino]benzoate (PubChem CID 94027087) has the molecular formula C24H29ClN2O5S and a molecular weight of 493.03 g/mol. Its IUPAC name is ethyl 3-chloro-4-[[(3R)-1-(3-phenylpropylsulfonyl)piperidine-3-carbonyl]amino]benzoate.
| Compound Name | ethyl 3-chloro-4-[[(3R)-1-(3-phenylpropylsulfonyl)piperidine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 94027087 |
| Molecular Formula | C24H29ClN2O5S |
| Molecular Weight | 493.03 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | ethyl 3-chloro-4-[[(3R)-1-(3-phenylpropylsulfonyl)piperidine-3-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)[C@@H]2CCCN(S(=O)(=O)CCCc3ccccc3)C2)c(Cl)c1 |
| InChI | InChI=1S/C24H29ClN2O5S/c1-2-32-24(29)19-12-13-22(21(25)16-19)26-23(28)20-11-6-14-27(17-20)33(30,31)15-7-10-18-8-4-3-5-9-18/h3-5,8-9,12-13,16,20H,2,6-7,10-11,14-15,17H2,1H3,(H,26,28)/t20-/m1/s1 |
| InChIKey | NNLSRVTUOAVXQD-HXUWFJFHSA-N |
| XLogP | 4.13 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.03 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |