C23H25NO3 — CID 94028066
(2S)-N-[(2-ethoxyphenyl)methyl]-2-naphthalen-1-yloxybutanamide (PubChem CID 94028066) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is (2S)-N-[(2-ethoxyphenyl)methyl]-2-naphthalen-1-yloxybutanamide.
| Compound Name | (2S)-N-[(2-ethoxyphenyl)methyl]-2-naphthalen-1-yloxybutanamide |
|---|---|
| PubChem CID | 94028066 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (2S)-N-[(2-ethoxyphenyl)methyl]-2-naphthalen-1-yloxybutanamide |
| SMILES | CCOc1ccccc1CNC(=O)[C@H](CC)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C23H25NO3/c1-3-20(27-22-15-9-12-17-10-5-7-13-19(17)22)23(25)24-16-18-11-6-8-14-21(18)26-4-2/h5-15,20H,3-4,16H2,1-2H3,(H,24,25)/t20-/m0/s1 |
| InChIKey | PAKIRDHZXMSLHF-FQEVSTJZSA-N |
| XLogP | 4.71 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |