C15H22N4O3 — CID 94031851
1-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-oxopropyl]-3-pyridin-3-ylurea (PubChem CID 94031851) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is 1-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-oxopropyl]-3-pyridin-3-ylurea.
| Compound Name | 1-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-oxopropyl]-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 94031851 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 1-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-oxopropyl]-3-pyridin-3-ylurea |
| SMILES | C[C@H]1CN(C(=O)CCNC(=O)Nc2cccnc2)C[C@H](C)O1 |
| InChI | InChI=1S/C15H22N4O3/c1-11-9-19(10-12(2)22-11)14(20)5-7-17-15(21)18-13-4-3-6-16-8-13/h3-4,6,8,11-12H,5,7,9-10H2,1-2H3,(H2,17,18,21)/t11-,12-/m0/s1 |
| InChIKey | SNLDBEXTZWQUCE-RYUDHWBXSA-N |
| XLogP | 1.23 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |