C16H15F3N2O3 — CID 94031986
N-[(2S)-1-oxo-1-[[3-(trifluoromethyl)phenyl]methylamino]propan-2-yl]furan-3-carboxamide (PubChem CID 94031986) has the molecular formula C16H15F3N2O3 and a molecular weight of 340.30 g/mol. Its IUPAC name is N-[(2S)-1-oxo-1-[[3-(trifluoromethyl)phenyl]methylamino]propan-2-yl]furan-3-carboxamide.
| Compound Name | N-[(2S)-1-oxo-1-[[3-(trifluoromethyl)phenyl]methylamino]propan-2-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 94031986 |
| Molecular Formula | C16H15F3N2O3 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-[(2S)-1-oxo-1-[[3-(trifluoromethyl)phenyl]methylamino]propan-2-yl]furan-3-carboxamide |
| SMILES | C[C@H](NC(=O)c1ccoc1)C(=O)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H15F3N2O3/c1-10(21-15(23)12-5-6-24-9-12)14(22)20-8-11-3-2-4-13(7-11)16(17,18)19/h2-7,9-10H,8H2,1H3,(H,20,22)(H,21,23)/t10-/m0/s1 |
| InChIKey | VYSSRFMYGVLNTQ-JTQLQIEISA-N |
| XLogP | 2.73 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |