C17H18N4S — CID 94032734
2-[[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]methyl]quinazolin-4-amine (PubChem CID 94032734) has the molecular formula C17H18N4S and a molecular weight of 310.43 g/mol. Its IUPAC name is 2-[[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]methyl]quinazolin-4-amine.
| Compound Name | 2-[[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 94032734 |
| Molecular Formula | C17H18N4S |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-[[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]methyl]quinazolin-4-amine |
| SMILES | Nc1nc(CN2CCC[C@@H]2c2ccsc2)nc2ccccc12 |
| InChI | InChI=1S/C17H18N4S/c18-17-13-4-1-2-5-14(13)19-16(20-17)10-21-8-3-6-15(21)12-7-9-22-11-12/h1-2,4-5,7,9,11,15H,3,6,8,10H2,(H2,18,19,20)/t15-/m1/s1 |
| InChIKey | HOZXBWDZEZGYTI-OAHLLOKOSA-N |
| XLogP | 3.61 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |