C22H18ClNO2S — CID 94033978
3-(4-chlorophenyl)sulfanyl-4-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]cyclobut-3-ene-1,2-dione (PubChem CID 94033978) has the molecular formula C22H18ClNO2S and a molecular weight of 395.91 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfanyl-4-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(4-chlorophenyl)sulfanyl-4-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 94033978 |
| Molecular Formula | C22H18ClNO2S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 3-(4-chlorophenyl)sulfanyl-4-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]cyclobut-3-ene-1,2-dione |
| SMILES | CN1/C(=C\c2c(Sc3ccc(Cl)cc3)c(=O)c2=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C22H18ClNO2S/c1-22(2)16-6-4-5-7-17(16)24(3)18(22)12-15-19(25)20(26)21(15)27-14-10-8-13(23)9-11-14/h4-12H,1-3H3/b18-12- |
| InChIKey | HYUDUSILHJBMLE-PDGQHHTCSA-N |
| XLogP | 4.86 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|