C21H34NO2+ — CID 940345
1-[[(2R,4S)-2-[2-(4-tert-butylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl]-1-methylpyrrolidin-1-ium (PubChem CID 940345) has the molecular formula C21H34NO2+ and a molecular weight of 332.51 g/mol. Its IUPAC name is 1-[[(2R,4S)-2-[2-(4-tert-butylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl]-1-methylpyrrolidin-1-ium.
| Compound Name | 1-[[(2R,4S)-2-[2-(4-tert-butylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl]-1-methylpyrrolidin-1-ium |
|---|---|
| PubChem CID | 940345 |
| Molecular Formula | C21H34NO2+ |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | 1-[[(2R,4S)-2-[2-(4-tert-butylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl]-1-methylpyrrolidin-1-ium |
| SMILES | CC(C)(C)c1ccc(CC[C@@H]2OC[C@H](C[N+]3(C)CCCC3)O2)cc1 |
| InChI | InChI=1S/C21H34NO2/c1-21(2,3)18-10-7-17(8-11-18)9-12-20-23-16-19(24-20)15-22(4)13-5-6-14-22/h7-8,10-11,19-20H,5-6,9,12-16H2,1-4H3/q+1/t19-,20+/m0/s1 |
| InChIKey | KHXWWYCKNCJMQT-VQTJNVASSA-N |
| XLogP | 3.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|