C7H12O3S — CID 94034660
(2R,6S)-2,6-dimethyl-1,1-dioxothian-4-one (PubChem CID 94034660) has the molecular formula C7H12O3S and a molecular weight of 176.24 g/mol. Its IUPAC name is (2R,6S)-2,6-dimethyl-1,1-dioxothian-4-one.
| Compound Name | (2R,6S)-2,6-dimethyl-1,1-dioxothian-4-one |
|---|---|
| PubChem CID | 94034660 |
| Molecular Formula | C7H12O3S |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | (2R,6S)-2,6-dimethyl-1,1-dioxothian-4-one |
| SMILES | C[C@@H]1CC(=O)C[C@H](C)S1(=O)=O |
| InChI | InChI=1S/C7H12O3S/c1-5-3-7(8)4-6(2)11(5,9)10/h5-6H,3-4H2,1-2H3/t5-,6+ |
| InChIKey | CDMBIRSYFONEKJ-OLQVQODUSA-N |
| XLogP | 0.54 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |