C11H12O — CID 94034991
[(1R,2R,5R,6S)-7-tricyclo[4.2.2.02,5]deca-3,7,9-trienyl]methanol (PubChem CID 94034991) has the molecular formula C11H12O and a molecular weight of 160.22 g/mol. Its IUPAC name is [(1R,2R,5R,6S)-7-tricyclo[4.2.2.02,5]deca-3,7,9-trienyl]methanol.
| Compound Name | [(1R,2R,5R,6S)-7-tricyclo[4.2.2.02,5]deca-3,7,9-trienyl]methanol |
|---|---|
| PubChem CID | 94034991 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | [(1R,2R,5R,6S)-7-tricyclo[4.2.2.02,5]deca-3,7,9-trienyl]methanol |
| SMILES | OCC1=C[C@@H]2C=C[C@H]1[C@@H]1C=C[C@H]21 |
| InChI | InChI=1S/C11H12O/c12-6-8-5-7-1-2-10(8)11-4-3-9(7)11/h1-5,7,9-12H,6H2/t7-,9+,10+,11+/m0/s1 |
| InChIKey | UQYFYDTWFAPFIG-AYHFEMFVSA-N |
| XLogP | 1.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|