C13H13NO3S — CID 94036706
(3-hydroxy-1-benzothiophen-2-yl)-morpholin-4-ylmethanone (PubChem CID 94036706) has the molecular formula C13H13NO3S and a molecular weight of 263.32 g/mol. Its IUPAC name is (3-hydroxy-1-benzothiophen-2-yl)-morpholin-4-ylmethanone.
| Compound Name | (3-hydroxy-1-benzothiophen-2-yl)-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 94036706 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | (3-hydroxy-1-benzothiophen-2-yl)-morpholin-4-ylmethanone |
| SMILES | O=C(c1sc2ccccc2c1O)N1CCOCC1 |
| InChI | InChI=1S/C13H13NO3S/c15-11-9-3-1-2-4-10(9)18-12(11)13(16)14-5-7-17-8-6-14/h1-4,15H,5-8H2 |
| InChIKey | MZWGCZIYWZBRNO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|