(2S,4S,6R)-6-amino-2,4-dimethylheptanoic acid

C9H19NO2 — CID 94036784

IUPAC(2S,4S,6R)-6-amino-2,4-dimethylheptanoic acid
SMILESC[C@H](C[C@@H](C)N)C[C@H](C)C(=O)O
InChIInChI=1S/C9H19NO2/c1-6(5-8(3)10)4-7(2)9(11)12/h6-8H,4-5,10H2,1-3H3,(H,11,12)/t6-,7-,8+/m0/s1
InChIKeyAJQBGZWGIBGLFK-BIIVOSGPSA-N
MW173.26 g/mol
LogP1.47
Rot. Bonds5

About (2S,4S,6R)-6-amino-2,4-dimethylheptanoic acid

(2S,4S,6R)-6-amino-2,4-dimethylheptanoic acid (PubChem CID 94036784) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is (2S,4S,6R)-6-amino-2,4-dimethylheptanoic acid.

Molecular Properties

Compound Name(2S,4S,6R)-6-amino-2,4-dimethylheptanoic acid
PubChem CID94036784
Molecular FormulaC9H19NO2
Molecular Weight173.26 g/mol
Exact Mass173.14
IUPAC Name(2S,4S,6R)-6-amino-2,4-dimethylheptanoic acid
SMILESC[C@H](C[C@@H](C)N)C[C@H](C)C(=O)O
InChIInChI=1S/C9H19NO2/c1-6(5-8(3)10)4-7(2)9(11)12/h6-8H,4-5,10H2,1-3H3,(H,11,12)/t6-,7-,8+/m0/s1
InChIKeyAJQBGZWGIBGLFK-BIIVOSGPSA-N
XLogP1.47
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500173.26
LogP ≤ 51.47
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2S,4S,6R)-6-amino-2,4-dimethylheptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,4S,6R)-6-amino-2,4-dimethylheptanoic acid?
The IUPAC name of (2S,4S,6R)-6-amino-2,4-dimethylheptanoic acid (CID 94036784) is (2S,4S,6R)-6-amino-2,4-dimethylheptanoic acid.
What is the SMILES notation for (2S,4S,6R)-6-amino-2,4-dimethylheptanoic acid?
The canonical SMILES for (2S,4S,6R)-6-amino-2,4-dimethylheptanoic acid is C[C@H](C[C@@H](C)N)C[C@H](C)C(=O)O.
What is the InChIKey of (2S,4S,6R)-6-amino-2,4-dimethylheptanoic acid?
The InChIKey is AJQBGZWGIBGLFK-BIIVOSGPSA-N. The full InChI is InChI=1S/C9H19NO2/c1-6(5-8(3)10)4-7(2)9(11)12/h6-8H,4-5,10H2,1-3H3,(H,11,12)/t6-,7-,8+/m0/s1.
What are the key properties of (2S,4S,6R)-6-amino-2,4-dimethylheptanoic acid?
(2S,4S,6R)-6-amino-2,4-dimethylheptanoic acid has a molecular weight of 173.26 g/mol, XLogP of 1.47, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S,6R)-6-amino-2,4-dimethylheptanoic acid is sourced from PubChem (CID 94036784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).