About methyl (1S,6R)-1,6-dimethyl-7-azabicyclo[4.2.0]octane-7-carboxylate
methyl (1S,6R)-1,6-dimethyl-7-azabicyclo[4.2.0]octane-7-carboxylate (PubChem CID 94036888) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is methyl (1S,6R)-1,6-dimethyl-7-azabicyclo[4.2.0]octane-7-carboxylate.
Molecular Properties
| Compound Name | methyl (1S,6R)-1,6-dimethyl-7-azabicyclo[4.2.0]octane-7-carboxylate |
| PubChem CID | 94036888 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | methyl (1S,6R)-1,6-dimethyl-7-azabicyclo[4.2.0]octane-7-carboxylate |
| SMILES | COC(=O)N1C[C@]2(C)CCCC[C@@]12C |
| InChI | InChI=1S/C11H19NO2/c1-10-6-4-5-7-11(10,2)12(8-10)9(13)14-3/h4-8H2,1-3H3/t10-,11+/m0/s1 |
| InChIKey | UKIJZVGBXDNOAT-WDEREUQCSA-N |
| XLogP | 2.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl (1S,6R)-1,6-dimethyl-7-azabicyclo[4.2.0]octane-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (1S,6R)-1,6-dimethyl-7-azabicyclo[4.2.0]octane-7-carboxylate?
The IUPAC name of methyl (1S,6R)-1,6-dimethyl-7-azabicyclo[4.2.0]octane-7-carboxylate (CID 94036888) is methyl (1S,6R)-1,6-dimethyl-7-azabicyclo[4.2.0]octane-7-carboxylate.
What is the SMILES notation for methyl (1S,6R)-1,6-dimethyl-7-azabicyclo[4.2.0]octane-7-carboxylate?
The canonical SMILES for methyl (1S,6R)-1,6-dimethyl-7-azabicyclo[4.2.0]octane-7-carboxylate is COC(=O)N1C[C@]2(C)CCCC[C@@]12C.
What is the InChIKey of methyl (1S,6R)-1,6-dimethyl-7-azabicyclo[4.2.0]octane-7-carboxylate?
The InChIKey is UKIJZVGBXDNOAT-WDEREUQCSA-N. The full InChI is InChI=1S/C11H19NO2/c1-10-6-4-5-7-11(10,2)12(8-10)9(13)14-3/h4-8H2,1-3H3/t10-,11+/m0/s1.
What are the key properties of methyl (1S,6R)-1,6-dimethyl-7-azabicyclo[4.2.0]octane-7-carboxylate?
methyl (1S,6R)-1,6-dimethyl-7-azabicyclo[4.2.0]octane-7-carboxylate has a molecular weight of 197.28 g/mol, XLogP of 2.41, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1S,6R)-1,6-dimethyl-7-azabicyclo[4.2.0]octane-7-carboxylate is sourced from PubChem (CID 94036888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).