About (4R,7R)-tricyclo[5.2.1.04,10]decan-1-ol
(4R,7R)-tricyclo[5.2.1.04,10]decan-1-ol (PubChem CID 94036934) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is (4R,7R)-tricyclo[5.2.1.04,10]decan-1-ol.
Molecular Properties
| Compound Name | (4R,7R)-tricyclo[5.2.1.04,10]decan-1-ol |
| PubChem CID | 94036934 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (4R,7R)-tricyclo[5.2.1.04,10]decan-1-ol |
| SMILES | OC12CC[C@H]3CC[C@H](CC1)C32 |
| InChI | InChI=1S/C10H16O/c11-10-5-3-7-1-2-8(4-6-10)9(7)10/h7-9,11H,1-6H2/t7-,8-,9?,10?/m1/s1 |
| InChIKey | DSJRZUKMRBVKHA-LGUIWLBCSA-N |
| XLogP | 1.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4R,7R)-tricyclo[5.2.1.04,10]decan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,7R)-tricyclo[5.2.1.04,10]decan-1-ol?
The IUPAC name of (4R,7R)-tricyclo[5.2.1.04,10]decan-1-ol (CID 94036934) is (4R,7R)-tricyclo[5.2.1.04,10]decan-1-ol.
What is the SMILES notation for (4R,7R)-tricyclo[5.2.1.04,10]decan-1-ol?
The canonical SMILES for (4R,7R)-tricyclo[5.2.1.04,10]decan-1-ol is OC12CC[C@H]3CC[C@H](CC1)C32.
What is the InChIKey of (4R,7R)-tricyclo[5.2.1.04,10]decan-1-ol?
The InChIKey is DSJRZUKMRBVKHA-LGUIWLBCSA-N. The full InChI is InChI=1S/C10H16O/c11-10-5-3-7-1-2-8(4-6-10)9(7)10/h7-9,11H,1-6H2/t7-,8-,9?,10?/m1/s1.
What are the key properties of (4R,7R)-tricyclo[5.2.1.04,10]decan-1-ol?
(4R,7R)-tricyclo[5.2.1.04,10]decan-1-ol has a molecular weight of 152.24 g/mol, XLogP of 1.95, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,7R)-tricyclo[5.2.1.04,10]decan-1-ol is sourced from PubChem (CID 94036934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).