C15H10N4O — CID 94037177
(1R,4S)-7-methoxytricyclo[5.2.1.04,10]deca-5,8-diene-2,2,3,3-tetracarbonitrile (PubChem CID 94037177) has the molecular formula C15H10N4O and a molecular weight of 262.27 g/mol. Its IUPAC name is (1R,4S)-7-methoxytricyclo[5.2.1.04,10]deca-5,8-diene-2,2,3,3-tetracarbonitrile.
| Compound Name | (1R,4S)-7-methoxytricyclo[5.2.1.04,10]deca-5,8-diene-2,2,3,3-tetracarbonitrile |
|---|---|
| PubChem CID | 94037177 |
| Molecular Formula | C15H10N4O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | (1R,4S)-7-methoxytricyclo[5.2.1.04,10]deca-5,8-diene-2,2,3,3-tetracarbonitrile |
| SMILES | COC12C=C[C@@H]3C1[C@H](C=C2)C(C#N)(C#N)C3(C#N)C#N |
| InChI | InChI=1S/C15H10N4O/c1-20-15-4-2-10-12(15)11(3-5-15)14(8-18,9-19)13(10,6-16)7-17/h2-5,10-12H,1H3/t10-,11+,12?,15? |
| InChIKey | RSCUMOIQLPYBJG-QOARYFPJSA-N |
| XLogP | 1.44 |
| TPSA | 104.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|