C22H23N3O2 — CID 94037211
(1R,6R,9R,10S)-7,8-dimethyl-13-phenyl-11,13,15-triazapentacyclo[8.5.2.01,6.06,9.011,15]heptadeca-7,16-diene-12,14-dione (PubChem CID 94037211) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is (1R,6R,9R,10S)-7,8-dimethyl-13-phenyl-11,13,15-triazapentacyclo[8.5.2.01,6.06,9.011,15]heptadeca-7,16-diene-12,14-dione.
| Compound Name | (1R,6R,9R,10S)-7,8-dimethyl-13-phenyl-11,13,15-triazapentacyclo[8.5.2.01,6.06,9.011,15]heptadeca-7,16-diene-12,14-dione |
|---|---|
| PubChem CID | 94037211 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | (1R,6R,9R,10S)-7,8-dimethyl-13-phenyl-11,13,15-triazapentacyclo[8.5.2.01,6.06,9.011,15]heptadeca-7,16-diene-12,14-dione |
| SMILES | CC1=C(C)[C@]23CCCC[C@@]24C=C[C@@H]([C@H]13)n1c(=O)n(-c2ccccc2)c(=O)n14 |
| InChI | InChI=1S/C22H23N3O2/c1-14-15(2)22-12-7-6-11-21(22)13-10-17(18(14)22)24-19(26)23(20(27)25(21)24)16-8-4-3-5-9-16/h3-5,8-10,13,17-18H,6-7,11-12H2,1-2H3/t17-,18-,21+,22-/m0/s1 |
| InChIKey | GNNAFUMGNUPJIZ-HXHBTQRASA-N |
| XLogP | 3.15 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|