C20H26N2O3S2 — CID 94038343
(2S)-N-benzyl-2-[[3-(dimethylsulfamoyl)phenyl]methylsulfanyl]-N-methylpropanamide (PubChem CID 94038343) has the molecular formula C20H26N2O3S2 and a molecular weight of 406.57 g/mol. Its IUPAC name is (2S)-N-benzyl-2-[[3-(dimethylsulfamoyl)phenyl]methylsulfanyl]-N-methylpropanamide.
| Compound Name | (2S)-N-benzyl-2-[[3-(dimethylsulfamoyl)phenyl]methylsulfanyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 94038343 |
| Molecular Formula | C20H26N2O3S2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | (2S)-N-benzyl-2-[[3-(dimethylsulfamoyl)phenyl]methylsulfanyl]-N-methylpropanamide |
| SMILES | C[C@H](SCc1cccc(S(=O)(=O)N(C)C)c1)C(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C20H26N2O3S2/c1-16(20(23)22(4)14-17-9-6-5-7-10-17)26-15-18-11-8-12-19(13-18)27(24,25)21(2)3/h5-13,16H,14-15H2,1-4H3/t16-/m0/s1 |
| InChIKey | GQOQVWXGGCSUDP-INIZCTEOSA-N |
| XLogP | 3.22 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |