About 1-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-[(6-methoxy-3-pyridinyl)methyl]urea
1-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-[(6-methoxy-3-pyridinyl)methyl]urea (PubChem CID 94039689) has the molecular formula C17H18FN3O2S
and a molecular weight of 347.42 g/mol. Its IUPAC name is 1-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-[(6-methoxy-3-pyridinyl)methyl]urea.
Molecular Properties
| Compound Name | 1-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-[(6-methoxy-3-pyridinyl)methyl]urea |
| PubChem CID | 94039689 |
| Molecular Formula | C17H18FN3O2S |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 1-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-[(6-methoxy-3-pyridinyl)methyl]urea |
| SMILES | COc1ccc(CNC(=O)N[C@@H]2CCSc3ccc(F)cc32)cn1 |
| InChI | InChI=1S/C17H18FN3O2S/c1-23-16-5-2-11(9-19-16)10-20-17(22)21-14-6-7-24-15-4-3-12(18)8-13(14)15/h2-5,8-9,14H,6-7,10H2,1H3,(H2,20,21,22)/t14-/m1/s1 |
| InChIKey | JVGIHKIKTPSXDR-CQSZACIVSA-N |
| XLogP | 3.27 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-[(6-methoxy-3-pyridinyl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-[(6-methoxy-3-pyridinyl)methyl]urea?
The IUPAC name of 1-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-[(6-methoxy-3-pyridinyl)methyl]urea (CID 94039689) is 1-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-[(6-methoxy-3-pyridinyl)methyl]urea.
What is the SMILES notation for 1-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-[(6-methoxy-3-pyridinyl)methyl]urea?
The canonical SMILES for 1-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-[(6-methoxy-3-pyridinyl)methyl]urea is COc1ccc(CNC(=O)N[C@@H]2CCSc3ccc(F)cc32)cn1.
What is the InChIKey of 1-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-[(6-methoxy-3-pyridinyl)methyl]urea?
The InChIKey is JVGIHKIKTPSXDR-CQSZACIVSA-N. The full InChI is InChI=1S/C17H18FN3O2S/c1-23-16-5-2-11(9-19-16)10-20-17(22)21-14-6-7-24-15-4-3-12(18)8-13(14)15/h2-5,8-9,14H,6-7,10H2,1H3,(H2,20,21,22)/t14-/m1/s1.
What are the key properties of 1-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-[(6-methoxy-3-pyridinyl)methyl]urea?
1-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-[(6-methoxy-3-pyridinyl)methyl]urea has a molecular weight of 347.42 g/mol, XLogP of 3.27, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4R)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-[(6-methoxy-3-pyridinyl)methyl]urea is sourced from PubChem (CID 94039689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).