C19H20ClNO2 — CID 94041150
1-[(2R)-2-(4-chlorophenyl)pyrrolidin-1-yl]-2-(4-methoxyphenyl)ethanone (PubChem CID 94041150) has the molecular formula C19H20ClNO2 and a molecular weight of 329.83 g/mol. Its IUPAC name is 1-[(2R)-2-(4-chlorophenyl)pyrrolidin-1-yl]-2-(4-methoxyphenyl)ethanone.
| Compound Name | 1-[(2R)-2-(4-chlorophenyl)pyrrolidin-1-yl]-2-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 94041150 |
| Molecular Formula | C19H20ClNO2 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 1-[(2R)-2-(4-chlorophenyl)pyrrolidin-1-yl]-2-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(CC(=O)N2CCC[C@@H]2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H20ClNO2/c1-23-17-10-4-14(5-11-17)13-19(22)21-12-2-3-18(21)15-6-8-16(20)9-7-15/h4-11,18H,2-3,12-13H2,1H3/t18-/m1/s1 |
| InChIKey | GPITZVHPGGJQNJ-GOSISDBHSA-N |
| XLogP | 4.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |